Target Relevance

Molecular Definition

Canonical SMILES CCC(O)[C@@H]1CC[C@@H](CC1)N2CC(C2)NC(=O)CNc3nccc4ccc(cc34)C(F)(F)C(F)(F)F
Formula C25H31F5N4O2
Molecular Weight 514.53 da
Stereocenters 2/3