Molecular Definition

Canonical SMILES CN(C(=O)c1cc(F)c(cc1Cl)C(=O)NS(=O)(=O)C)C23CC4CC(CC(C4)C2)C3
Formula C20H24ClFN2O4S
Molecular Weight 442.93 da
Stereocenters 0/0