Molecular Definition

Canonical SMILES CS(=O)(=O)NC(=O)c1cc(Cl)c(cc1F)C(=O)NC23CC4CC(CC(C4)C2)C3
Formula C19H22ClFN2O4S
Molecular Weight 428.91 da
Stereocenters 0/0