Target Relevance

Molecular Definition

Canonical SMILES Cc1c(c2ccc(O)cc2)n(Cc3ccc(OCCCN4CCCCC4)cc3)c5ccc(O)cc15
Formula C30H34N2O3
Molecular Weight 470.60 da
Stereocenters 0/0