Molecular Definition

Canonical SMILES CCNC(=O)c1n[nH]c(c2cc(Cl)c(O)cc2O)c1c3ccc(OC)cc3
Formula C19H18ClN3O4
Molecular Weight 387.82 da
Stereocenters 0/0