Molecular Definition

Canonical SMILES CC(C)(C)c1ccc(NC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)Nc4ccc(OCCC5CC5)cc4F)cc1
Formula C30H34FN3O4S
Molecular Weight 551.67 da
Stereocenters 0/0