Molecular Definition

Canonical SMILES CC(C)(C)c1cc(CN2CCc3cc(ccc3C2)S(=O)(=O)Nc4ccc(OCCC5CCOCC5)cc4F)ccn1
Formula C32H40FN3O4S
Molecular Weight 581.74 da
Stereocenters 0/0