Molecular Definition

Canonical SMILES CC(C)(C)c1cnc(CN2CCc3cc(ccc3C2)S(=O)(=O)Nc4ccc(CCCC5CCCC5)cc4F)cn1
Formula C32H41FN4O2S
Molecular Weight 564.76 da
Stereocenters 0/0