Molecular Definition

Canonical SMILES FC(F)C(F)(F)Oc1ccc(CN2CCc3cc(ccc3C2)S(=O)(=O)Nc4ccc(CCCC5CCCC5)cc4F)cc1
Formula C32H35F5N2O3S
Molecular Weight 622.69 da
Stereocenters 0/0