Molecular Definition

Canonical SMILES Fc1cc(CCCC2CCCC2)ccc1NS(=O)(=O)c3ccc4CN(Cc5ccc(OCC(F)(F)F)nc5)CCc4c3
Formula C31H35F4N3O3S
Molecular Weight 605.69 da
Stereocenters 0/0