Molecular Definition

Canonical SMILES CCCCCCCCN1CCc2cc(ccc2C1)S(=O)(=O)Nc3ccc(OCCCCCC)cc3F
Formula C29H43FN2O3S
Molecular Weight 518.73 da
Stereocenters 0/0