Molecular Definition

Canonical SMILES CC(C)(C)[C@@H]1CC[C@@H](CC1)C(=O)N2CCc3cc(ccc3C2)S(=O)(=O)Nc4ccc(CCCC5CCCC5)cc4F
Formula C34H47FN2O3S
Molecular Weight 582.81 da
Stereocenters 2/2