Molecular Definition

Canonical SMILES CS(=O)(=O)NC(=O)c1cc(F)c(OCC2CCCNC2)cc1F
Formula C14H18F2N2O4S
Molecular Weight 348.37 da
Stereocenters 0/1