Molecular Definition

Canonical SMILES CC(C)(C)OC(=O)N1CCCC(COc2cc(F)c(cc2F)C(=O)NS(=O)(=O)C)C1
Formula C19H26F2N2O6S
Molecular Weight 448.48 da
Stereocenters 0/1