Molecular Definition

Canonical SMILES CN([C@@H]1CC[C@@H](CS(=O)(=O)N2CC[C@@H](C2)OCC(=O)N3CCCC3)CC1)c4ncnc5[nH]ccc45
Formula C24H36N6O4S
Molecular Weight 504.65 da
Stereocenters 3/3