Target Relevance

Molecular Definition

Canonical SMILES CCCC1=C(Cc2ccc(cc2)c3ccccc3C4=NC(=O)ON4)C(=O)N([C@@H]5CC[C@@](C)(CO)CC5)c6ncnn16
Formula C31H34N6O4
Molecular Weight 554.64 da
Stereocenters 2/2