Molecular Definition

Canonical SMILES CCCC1=C(Cc2ccc(cc2)c3ccccc3c4nnn[nH]4)C(=O)N(C5CCC6(CC5)OC(C)(C)C(C)(C)O6)c7ncnn17
Formula C34H40N8O3
Molecular Weight 608.73 da
Stereocenters 0/0