Target Relevance

Molecular Definition

Canonical SMILES CCCC1=C(Cc2ccc(cc2)c3ccccc3C4=NC(=O)ON4)C(=O)N(C5CCC6(CC5)OC(C)(C)C(C)(C)O6)c7ncnn17
Formula C35H40N6O5
Molecular Weight 624.73 da
Stereocenters 0/0