Target Relevance

Glucagon Tchem
pKi 70819 6.4

Molecular Definition

Canonical SMILES CCCC(Nc1ccc(cn1)C(=O)NCCC(=O)O)c2ccc(nc2)n3cc(cn3)C(F)(F)F
Formula C22H23F3N6O3
Molecular Weight 476.45 da
Stereocenters 0/1