Target Relevance

Glucagon Tchem
pKi 70819 6.37

Molecular Definition

Canonical SMILES OC(=O)CCNC(=O)c1ccc(cc1)C(Nc2ccc(nc2)n3cc(cn3)C(F)(F)F)C4CCOCC4
Formula C25H26F3N5O4
Molecular Weight 517.50 da
Stereocenters 0/1