Target Relevance

Glucagon Tchem
pKi 70819 6.35

Molecular Definition

Canonical SMILES CCCC(Oc1cnc(c(C)c1)n2cc(cn2)C(F)(F)F)c3ccc(cc3)C(=O)NCCC(=O)O
Formula C24H25F3N4O4
Molecular Weight 490.47 da
Stereocenters 0/1