Target Relevance

Glucagon Tchem
pKi 70819 6.45

Molecular Definition

Canonical SMILES CCCC(Oc1ccc(cc1)n2cc3cccc(Cl)c3n2)c4ccc(cc4)C(=O)NCCC(=O)O
Formula C27H26ClN3O4
Molecular Weight 491.97 da
Stereocenters 0/1