Target Relevance

Glucagon Tchem
pKi 70819 6.5

Molecular Definition

Canonical SMILES CCCC(Oc1ccc(cc1)n2cc3c(C)cccc3n2)c4ccc(cc4)C(=O)NCCC(=O)O
Formula C28H29N3O4
Molecular Weight 471.55 da
Stereocenters 0/1