Target Relevance

Glucagon Tchem
pKi 70819 6.53

Molecular Definition

Canonical SMILES Cc1cc(ccc1C(Nc2ccc(cn2)C(=O)NCCC(=O)O)C3CCCCC3)n4cc(cn4)C(F)(F)F
Formula C27H30F3N5O3
Molecular Weight 529.55 da
Stereocenters 0/1