Target Relevance

Glucagon Tchem
pKi 70819 6.18

Molecular Definition

Canonical SMILES CCCC(Oc1ccc(cc1)n2cc(Cl)c(C)n2)c3ccc(cc3)C(=O)NCCC(=O)O
Formula C24H26ClN3O4
Molecular Weight 455.93 da
Stereocenters 0/1