Molecular Definition

Canonical SMILES COC[C@H](Nc1nc(Nc2ccc(cc2)S(=N)(=O)C)ncc1Br)[C@H](C)O
Formula C16H22BrN5O3S
Molecular Weight 444.35 da
Stereocenters 2/2