Molecular Definition

Canonical SMILES C[C@H](Nc1nc(Nc2ccc(cc2)S(=N)(=O)CCO)ncc1Br)C(C)(C)O
Formula C17H24BrN5O3S
Molecular Weight 458.37 da
Stereocenters 1/1