Molecular Definition

Canonical SMILES CCOC(=O)N=S(=O)(C)c1ccc(Nc2ncc(Br)c(N[C@H](C)C(C)(C)O)n2)cc1
Formula C19H26BrN5O4S
Molecular Weight 500.41 da
Stereocenters 1/1