Molecular Definition

Canonical SMILES CCCc1cc2c(noc2c(CCC)c1OC(C)(CC)C(=O)O)C(F)(F)F
Formula C19H24F3NO4
Molecular Weight 387.39 da
Stereocenters 0/1