Molecular Definition

Canonical SMILES CCn1nc(C2CC2)c(F)c1N3CCc4nc(nc(N5CC[C@@H](OC)C(C)(C)C5)c4C3)c6c(C)ccc7[nH]nc(C)c67
Formula C32H41FN8O
Molecular Weight 572.72 da
Stereocenters 1/1