Target Relevance

Molecular Definition

Canonical SMILES Fc1cccc(F)c1C(=O)Nc2ccc(s2)c3cccc(c3)c4ocnc4
Formula C20H12F2N2O2S
Molecular Weight 382.38 da
Stereocenters 0/0