Target Relevance

Molecular Definition

Canonical SMILES COC(=O)c1cccc(c1)c2sc(NC(=O)c3c(F)cccc3F)cc2C
Formula C20H15F2NO3S
Molecular Weight 387.40 da
Stereocenters 0/0