Target Relevance

Molecular Definition

Canonical SMILES Cc1ccc(cc1c2ccc(NC(=O)c3c(F)cccc3F)s2)c4occn4
Formula C21H14F2N2O2S
Molecular Weight 396.41 da
Stereocenters 0/0