Target Relevance

Molecular Definition

Canonical SMILES Fc1cccc(F)c1C(=O)Nc2ccc(s2)c3cccc(c3)C(F)(F)F
Formula C18H10F5NOS
Molecular Weight 383.34 da
Stereocenters 0/0