Target Relevance

Molecular Definition

Canonical SMILES COC(=O)c1ccc(C)c(c1)c2ccc(s2)C(=O)Nc3ccncc3C
Formula C20H18N2O3S
Molecular Weight 366.43 da
Stereocenters 0/0