Target Relevance

Molecular Definition

Canonical SMILES Fc1cccc(F)c1NC(=O)c2ccc(s2)c3cc(ccc3Cl)C(F)(F)F
Formula C18H9ClF5NOS
Molecular Weight 417.78 da
Stereocenters 0/0