Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1c2cccn3nc(Nc4cccc(c4)C5CCNCC5)nc23)C(F)(F)F
Formula C25H24F3N5O
Molecular Weight 467.49 da
Stereocenters 0/0