Target Relevance

Molecular Definition

Canonical SMILES COc1ccc2CN(C[C@]3(NC(=O)NC3=O)C#Cc4ccc(CC5(C)NC(=O)NC5=O)cc4)C(=O)c2c1
Formula C26H23N5O6
Molecular Weight 501.49 da
Stereocenters 1/2