Target Relevance

Molecular Definition

Canonical SMILES COc1ccc2CN(C[C@]3(NC(=O)NC3=O)C#Cc4cccnc4c5cn[nH]c5)C(=O)c2c1
Formula C23H18N6O4
Molecular Weight 442.43 da
Stereocenters 1/1