Molecular Definition

Canonical SMILES COc1cccnc1c2nc3cc(ccc3n2C(C)(C)C)c4cnc(N)nc4
Formula C21H22N6O
Molecular Weight 374.44 da
Stereocenters 0/0