Target Relevance

Molecular Definition

Canonical SMILES CCNc1oc(nn1)c2ccc(OC)c(n2)C#C[C@]3(CN4Cc5ccc(OC)cc5C4=O)NC(=O)NC3=O
Formula C25H23N7O6
Molecular Weight 517.49 da
Stereocenters 1/1