Target Relevance

Molecular Definition

Canonical SMILES CCN1CCN(CC1)C(=O)C2CN(C(=O)C2)c3ccc(cc3)C#C[C@]4(CN5Cc6ccc(OC)cc6C5=O)NC(=O)NC4=O
Formula C32H34N6O6
Molecular Weight 598.65 da
Stereocenters 1/2