Target Relevance

Molecular Definition

Canonical SMILES COc1ccc2CN(C[C@]3(NC(=O)NC3=O)C#Cc4cc(F)cnc4Cl)C(=O)c2c1F
Formula C20H13ClF2N4O4
Molecular Weight 446.79 da
Stereocenters 1/1