Target Relevance

Molecular Definition

Canonical SMILES COc1ccc2CN(C[C@]3(NC(=O)NC3=O)C#Cc4ccc5c(n[nH]c5c4)c6ccncc6)C(=O)c2c1
Formula C27H20N6O4
Molecular Weight 492.49 da
Stereocenters 1/1