Molecular Definition

Canonical SMILES C[C@H](NC(=O)CNC(=O)c1cccc(c1)C#N)c2ccccc2
Formula C18H17N3O2
Molecular Weight 307.35 da
Stereocenters 1/1