Molecular Definition

Canonical SMILES C[C@H](NC(=O)CNC(=O)c1cccc(C)c1)c2ccccc2
Formula C18H20N2O2
Molecular Weight 296.36 da
Stereocenters 1/1