Target Relevance

Molecular Definition

Canonical SMILES Oc1ccccc1C(=O)NNC(=S)NCc2ccccc2
Formula C15H15N3O2S
Molecular Weight 301.36 da
Stereocenters 0/0