Target Relevance

Molecular Definition

Canonical SMILES O=C(NNC(=S)NCc1ccccc1)c2ccncc2
Formula C14H14N4OS
Molecular Weight 286.35 da
Stereocenters 0/0