Molecular Definition

Canonical SMILES NCCCCn1c(SCCc2c[nH]c3cc(F)ccc23)nnc1c4ccc5ccccc5n4
Formula C25H25FN6S
Molecular Weight 460.57 da
Stereocenters 0/0