Molecular Definition

Canonical SMILES OC(O)[C@@H]1CCCN1C(=O)CNC2CC3CCCC2C3
Formula C15H26N2O3
Molecular Weight 282.38 da
Stereocenters 1/4